C34H60NO3+ — CID 20838799
1-[(E)-dodec-3-enyl]-1-[(E)-octadec-9-enoyl]pyrrolidin-1-ium-2,5-dione (PubChem CID 20838799) has the molecular formula C34H60NO3+ and a molecular weight of 530.86 g/mol. Its IUPAC name is 1-[(E)-dodec-3-enyl]-1-[(E)-octadec-9-enoyl]pyrrolidin-1-ium-2,5-dione.
| Compound Name | 1-[(E)-dodec-3-enyl]-1-[(E)-octadec-9-enoyl]pyrrolidin-1-ium-2,5-dione |
|---|---|
| PubChem CID | 20838799 |
| Molecular Formula | C34H60NO3+ |
| Molecular Weight | 530.86 g/mol |
| Exact Mass | 530.46 |
| IUPAC Name | 1-[(E)-dodec-3-enyl]-1-[(E)-octadec-9-enoyl]pyrrolidin-1-ium-2,5-dione |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)[N+]1(CC/C=C/CCCCCCCC)C(=O)CCC1=O |
| InChI | InChI=1S/C34H60NO3/c1-3-5-7-9-11-13-15-16-17-18-19-20-22-24-26-28-32(36)35(33(37)29-30-34(35)38)31-27-25-23-21-14-12-10-8-6-4-2/h16-17,23,25H,3-15,18-22,24,26-31H2,1-2H3/q+1/b17-16+,25-23+ |
| InChIKey | QBZCNXOQXMXENH-FARAALRRSA-N |
| XLogP | 9.91 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.86 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|