C17H28ClN3O4 — CID 20846917
(1S,2R,9S,10S)-6-methyl-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane-6-carbonitrile;perchloric acid (PubChem CID 20846917) has the molecular formula C17H28ClN3O4 and a molecular weight of 373.88 g/mol. Its IUPAC name is (1S,2R,9S,10S)-6-methyl-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane-6-carbonitrile;perchloric acid.
| Compound Name | (1S,2R,9S,10S)-6-methyl-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane-6-carbonitrile;perchloric acid |
|---|---|
| PubChem CID | 20846917 |
| Molecular Formula | C17H28ClN3O4 |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | (1S,2R,9S,10S)-6-methyl-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane-6-carbonitrile;perchloric acid |
| SMILES | CC1(C#N)CCC[C@@H]2[C@H]3C[C@@H](CN21)[C@@H]1CCCCN1C3.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C17H27N3.ClHO4/c1-17(12-18)7-4-6-16-13-9-14(11-20(16)17)15-5-2-3-8-19(15)10-13;2-1(3,4)5/h13-16H,2-11H2,1H3;(H,2,3,4,5)/t13-,14-,15-,16+,17?;/m0./s1 |
| InChIKey | RTWPSBVIQJXKOX-YMGOVGESSA-N |
| XLogP | -1.50 |
| TPSA | 119.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |