C15H23N5O4S2 — CID 20847904
1-amino-1-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)thiourea (PubChem CID 20847904) has the molecular formula C15H23N5O4S2 and a molecular weight of 401.51 g/mol. Its IUPAC name is 1-amino-1-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)thiourea.
| Compound Name | 1-amino-1-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)thiourea |
|---|---|
| PubChem CID | 20847904 |
| Molecular Formula | C15H23N5O4S2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 1-amino-1-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)thiourea |
| SMILES | NC(=S)N(N)c1cc(S(=O)(=O)N2CCOCC2)ccc1N1CCOCC1 |
| InChI | InChI=1S/C15H23N5O4S2/c16-15(25)20(17)14-11-12(26(21,22)19-5-9-24-10-6-19)1-2-13(14)18-3-7-23-8-4-18/h1-2,11H,3-10,17H2,(H2,16,25) |
| InChIKey | PNCILANWTFFZQP-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 114.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|