C22H29FN2O4S2 — CID 20860847
N-(3-cyclohexylsulfanylpropyl)-2-[[2-(2-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]methylsulfonyl]acetamide (PubChem CID 20860847) has the molecular formula C22H29FN2O4S2 and a molecular weight of 468.62 g/mol. Its IUPAC name is N-(3-cyclohexylsulfanylpropyl)-2-[[2-(2-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]methylsulfonyl]acetamide.
| Compound Name | N-(3-cyclohexylsulfanylpropyl)-2-[[2-(2-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]methylsulfonyl]acetamide |
|---|---|
| PubChem CID | 20860847 |
| Molecular Formula | C22H29FN2O4S2 |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | N-(3-cyclohexylsulfanylpropyl)-2-[[2-(2-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]methylsulfonyl]acetamide |
| SMILES | Cc1oc(-c2ccccc2F)nc1CS(=O)(=O)CC(=O)NCCCSC1CCCCC1 |
| InChI | InChI=1S/C22H29FN2O4S2/c1-16-20(25-22(29-16)18-10-5-6-11-19(18)23)14-31(27,28)15-21(26)24-12-7-13-30-17-8-3-2-4-9-17/h5-6,10-11,17H,2-4,7-9,12-15H2,1H3,(H,24,26) |
| InChIKey | XXZHRTMXBUIRHJ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|