C29H28N4O4 — CID 20868090
12-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-10-(propan-2-ylamino)-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one (PubChem CID 20868090) has the molecular formula C29H28N4O4 and a molecular weight of 496.57 g/mol. Its IUPAC name is 12-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-10-(propan-2-ylamino)-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one.
| Compound Name | 12-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-10-(propan-2-ylamino)-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one |
|---|---|
| PubChem CID | 20868090 |
| Molecular Formula | C29H28N4O4 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | 12-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-10-(propan-2-ylamino)-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one |
| SMILES | CC(C)Nc1cc(N2CCN(Cc3ccc4c(c3)OCO4)CC2)c2noc3c2c1C(=O)c1ccccc1-3 |
| InChI | InChI=1S/C29H28N4O4/c1-17(2)30-21-14-22(27-26-25(21)28(34)19-5-3-4-6-20(19)29(26)37-31-27)33-11-9-32(10-12-33)15-18-7-8-23-24(13-18)36-16-35-23/h3-8,13-14,17,30H,9-12,15-16H2,1-2H3 |
| InChIKey | JMDPSEJTIJDDLE-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 80.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'quinone_B(5)', 'substructure': 'N/A'} |
|---|