C34H28N4O6 — CID 46504378
12-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-10-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one (PubChem CID 46504378) has the molecular formula C34H28N4O6 and a molecular weight of 588.62 g/mol. Its IUPAC name is 12-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-10-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one.
| Compound Name | 12-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-10-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one |
|---|---|
| PubChem CID | 46504378 |
| Molecular Formula | C34H28N4O6 |
| Molecular Weight | 588.62 g/mol |
| Exact Mass | 588.20 |
| IUPAC Name | 12-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-10-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one |
| SMILES | O=C1c2ccccc2-c2onc3c(N4CCN(Cc5ccc6c(c5)OCO6)CC4)cc(Nc4ccc5c(c4)OCCO5)c1c23 |
| InChI | InChI=1S/C34H28N4O6/c39-33-22-3-1-2-4-23(22)34-31-30(33)24(35-21-6-8-26-29(16-21)41-14-13-40-26)17-25(32(31)36-44-34)38-11-9-37(10-12-38)18-20-5-7-27-28(15-20)43-19-42-27/h1-8,15-17,35H,9-14,18-19H2 |
| InChIKey | ONVJMLCCBIWRPN-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 98.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.62 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'quinone_B(5)', 'substructure': 'N/A'} |
|---|