C18H19N3O2 — CID 20901555
1-(2-ethylphenyl)-3-[(5-methyl-1,2-benzoxazol-3-yl)methyl]urea (PubChem CID 20901555) has the molecular formula C18H19N3O2 and a molecular weight of 309.37 g/mol. Its IUPAC name is 1-(2-ethylphenyl)-3-[(5-methyl-1,2-benzoxazol-3-yl)methyl]urea.
| Compound Name | 1-(2-ethylphenyl)-3-[(5-methyl-1,2-benzoxazol-3-yl)methyl]urea |
|---|---|
| PubChem CID | 20901555 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 1-(2-ethylphenyl)-3-[(5-methyl-1,2-benzoxazol-3-yl)methyl]urea |
| SMILES | CCc1ccccc1NC(=O)NCc1noc2ccc(C)cc12 |
| InChI | InChI=1S/C18H19N3O2/c1-3-13-6-4-5-7-15(13)20-18(22)19-11-16-14-10-12(2)8-9-17(14)23-21-16/h4-10H,3,11H2,1-2H3,(H2,19,20,22) |
| InChIKey | JHKLPRYYDJKNKJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |