C25H28FN3O2 — CID 20908160
1-(1-benzylpiperidin-4-yl)-3-(2-fluorophenyl)-1-[(5-methylfuran-2-yl)methyl]urea (PubChem CID 20908160) has the molecular formula C25H28FN3O2 and a molecular weight of 421.52 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-4-yl)-3-(2-fluorophenyl)-1-[(5-methylfuran-2-yl)methyl]urea.
| Compound Name | 1-(1-benzylpiperidin-4-yl)-3-(2-fluorophenyl)-1-[(5-methylfuran-2-yl)methyl]urea |
|---|---|
| PubChem CID | 20908160 |
| Molecular Formula | C25H28FN3O2 |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | 1-(1-benzylpiperidin-4-yl)-3-(2-fluorophenyl)-1-[(5-methylfuran-2-yl)methyl]urea |
| SMILES | Cc1ccc(CN(C(=O)Nc2ccccc2F)C2CCN(Cc3ccccc3)CC2)o1 |
| InChI | InChI=1S/C25H28FN3O2/c1-19-11-12-22(31-19)18-29(25(30)27-24-10-6-5-9-23(24)26)21-13-15-28(16-14-21)17-20-7-3-2-4-8-20/h2-12,21H,13-18H2,1H3,(H,27,30) |
| InChIKey | ONHUUVZRKXHXAQ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |