C24H21N3O4S — CID 20914177
6-[2-[4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)phenyl]ethyl]pyrrolo[3,4-b]pyridine-5,7-dione (PubChem CID 20914177) has the molecular formula C24H21N3O4S and a molecular weight of 447.52 g/mol. Its IUPAC name is 6-[2-[4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)phenyl]ethyl]pyrrolo[3,4-b]pyridine-5,7-dione.
| Compound Name | 6-[2-[4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)phenyl]ethyl]pyrrolo[3,4-b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 20914177 |
| Molecular Formula | C24H21N3O4S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | 6-[2-[4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)phenyl]ethyl]pyrrolo[3,4-b]pyridine-5,7-dione |
| SMILES | O=C1c2cccnc2C(=O)N1CCc1ccc(S(=O)(=O)N2CCc3ccccc3C2)cc1 |
| InChI | InChI=1S/C24H21N3O4S/c28-23-21-6-3-13-25-22(21)24(29)27(23)15-11-17-7-9-20(10-8-17)32(30,31)26-14-12-18-4-1-2-5-19(18)16-26/h1-10,13H,11-12,14-16H2 |
| InChIKey | YOHNVUNHVCQJAU-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 87.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|