C26H28N4O4S — CID 108781359
2-[2-[4-[(1-tert-butyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-yl)sulfonyl]phenyl]ethyl]isoindole-1,3-dione (PubChem CID 108781359) has the molecular formula C26H28N4O4S and a molecular weight of 492.60 g/mol. Its IUPAC name is 2-[2-[4-[(1-tert-butyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-yl)sulfonyl]phenyl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[4-[(1-tert-butyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-yl)sulfonyl]phenyl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 108781359 |
| Molecular Formula | C26H28N4O4S |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | 2-[2-[4-[(1-tert-butyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-yl)sulfonyl]phenyl]ethyl]isoindole-1,3-dione |
| SMILES | CC(C)(C)n1ncc2c1CCN(S(=O)(=O)c1ccc(CCN3C(=O)c4ccccc4C3=O)cc1)C2 |
| InChI | InChI=1S/C26H28N4O4S/c1-26(2,3)30-23-13-14-28(17-19(23)16-27-30)35(33,34)20-10-8-18(9-11-20)12-15-29-24(31)21-6-4-5-7-22(21)25(29)32/h4-11,16H,12-15,17H2,1-3H3 |
| InChIKey | JTJHJNRZIVIQTP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 92.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|