C20H21N3O4S — CID 6626101
6-[[4-(2-methylpiperidin-1-yl)sulfonylphenyl]methyl]pyrrolo[3,4-b]pyridine-5,7-dione (PubChem CID 6626101) has the molecular formula C20H21N3O4S and a molecular weight of 399.47 g/mol. Its IUPAC name is 6-[[4-(2-methylpiperidin-1-yl)sulfonylphenyl]methyl]pyrrolo[3,4-b]pyridine-5,7-dione.
| Compound Name | 6-[[4-(2-methylpiperidin-1-yl)sulfonylphenyl]methyl]pyrrolo[3,4-b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 6626101 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 6-[[4-(2-methylpiperidin-1-yl)sulfonylphenyl]methyl]pyrrolo[3,4-b]pyridine-5,7-dione |
| SMILES | CC1CCCCN1S(=O)(=O)c1ccc(CN2C(=O)c3cccnc3C2=O)cc1 |
| InChI | InChI=1S/C20H21N3O4S/c1-14-5-2-3-12-23(14)28(26,27)16-9-7-15(8-10-16)13-22-19(24)17-6-4-11-21-18(17)20(22)25/h4,6-11,14H,2-3,5,12-13H2,1H3 |
| InChIKey | RHTOSLVRWLBLON-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 87.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|