C18H19N3O4S2 — CID 20917687
6-[[5-(2-methylpiperidin-1-yl)sulfonylthiophen-2-yl]methyl]pyrrolo[3,4-b]pyridine-5,7-dione (PubChem CID 20917687) has the molecular formula C18H19N3O4S2 and a molecular weight of 405.50 g/mol. Its IUPAC name is 6-[[5-(2-methylpiperidin-1-yl)sulfonylthiophen-2-yl]methyl]pyrrolo[3,4-b]pyridine-5,7-dione.
| Compound Name | 6-[[5-(2-methylpiperidin-1-yl)sulfonylthiophen-2-yl]methyl]pyrrolo[3,4-b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 20917687 |
| Molecular Formula | C18H19N3O4S2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 6-[[5-(2-methylpiperidin-1-yl)sulfonylthiophen-2-yl]methyl]pyrrolo[3,4-b]pyridine-5,7-dione |
| SMILES | CC1CCCCN1S(=O)(=O)c1ccc(CN2C(=O)c3cccnc3C2=O)s1 |
| InChI | InChI=1S/C18H19N3O4S2/c1-12-5-2-3-10-21(12)27(24,25)15-8-7-13(26-15)11-20-17(22)14-6-4-9-19-16(14)18(20)23/h4,6-9,12H,2-3,5,10-11H2,1H3 |
| InChIKey | YAGGSOCBVMVFOZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 87.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|