C22H26N4O4S2 — CID 20917695
6-[[5-(4-cyclohexylpiperazin-1-yl)sulfonylthiophen-2-yl]methyl]pyrrolo[3,4-b]pyridine-5,7-dione (PubChem CID 20917695) has the molecular formula C22H26N4O4S2 and a molecular weight of 474.61 g/mol. Its IUPAC name is 6-[[5-(4-cyclohexylpiperazin-1-yl)sulfonylthiophen-2-yl]methyl]pyrrolo[3,4-b]pyridine-5,7-dione.
| Compound Name | 6-[[5-(4-cyclohexylpiperazin-1-yl)sulfonylthiophen-2-yl]methyl]pyrrolo[3,4-b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 20917695 |
| Molecular Formula | C22H26N4O4S2 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 6-[[5-(4-cyclohexylpiperazin-1-yl)sulfonylthiophen-2-yl]methyl]pyrrolo[3,4-b]pyridine-5,7-dione |
| SMILES | O=C1c2cccnc2C(=O)N1Cc1ccc(S(=O)(=O)N2CCN(C3CCCCC3)CC2)s1 |
| InChI | InChI=1S/C22H26N4O4S2/c27-21-18-7-4-10-23-20(18)22(28)26(21)15-17-8-9-19(31-17)32(29,30)25-13-11-24(12-14-25)16-5-2-1-3-6-16/h4,7-10,16H,1-3,5-6,11-15H2 |
| InChIKey | LMGIYTYQRAYDJJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 90.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|