C19H21N3O4S2 — CID 20917706
N-cyclohexyl-5-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-N-methylthiophene-2-sulfonamide (PubChem CID 20917706) has the molecular formula C19H21N3O4S2 and a molecular weight of 419.53 g/mol. Its IUPAC name is N-cyclohexyl-5-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-N-methylthiophene-2-sulfonamide.
| Compound Name | N-cyclohexyl-5-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-N-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 20917706 |
| Molecular Formula | C19H21N3O4S2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | N-cyclohexyl-5-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-N-methylthiophene-2-sulfonamide |
| SMILES | CN(C1CCCCC1)S(=O)(=O)c1ccc(CN2C(=O)c3cccnc3C2=O)s1 |
| InChI | InChI=1S/C19H21N3O4S2/c1-21(13-6-3-2-4-7-13)28(25,26)16-10-9-14(27-16)12-22-18(23)15-8-5-11-20-17(15)19(22)24/h5,8-11,13H,2-4,6-7,12H2,1H3 |
| InChIKey | WGGMCYPXXHIYOH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 87.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|