C20H16ClNO4 — CID 20917348
3-(4-chlorophenyl)-4-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylamino]cyclobut-3-ene-1,2-dione (PubChem CID 20917348) has the molecular formula C20H16ClNO4 and a molecular weight of 369.80 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-4-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylamino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(4-chlorophenyl)-4-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylamino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 20917348 |
| Molecular Formula | C20H16ClNO4 |
| Molecular Weight | 369.80 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 3-(4-chlorophenyl)-4-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylamino]cyclobut-3-ene-1,2-dione |
| SMILES | CC(Nc1c(-c2ccc(Cl)cc2)c(=O)c1=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C20H16ClNO4/c1-11(13-4-7-15-16(10-13)26-9-8-25-15)22-18-17(19(23)20(18)24)12-2-5-14(21)6-3-12/h2-7,10-11,22H,8-9H2,1H3 |
| InChIKey | YKZAYXHBFIGOFI-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.80 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|