C22H18FN3O4S — CID 20917803
2-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-N-(2-ethylphenyl)-5-fluorobenzenesulfonamide (PubChem CID 20917803) has the molecular formula C22H18FN3O4S and a molecular weight of 439.47 g/mol. Its IUPAC name is 2-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-N-(2-ethylphenyl)-5-fluorobenzenesulfonamide.
| Compound Name | 2-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-N-(2-ethylphenyl)-5-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 20917803 |
| Molecular Formula | C22H18FN3O4S |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | 2-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-N-(2-ethylphenyl)-5-fluorobenzenesulfonamide |
| SMILES | CCc1ccccc1NS(=O)(=O)c1cc(F)ccc1CN1C(=O)c2cccnc2C1=O |
| InChI | InChI=1S/C22H18FN3O4S/c1-2-14-6-3-4-8-18(14)25-31(29,30)19-12-16(23)10-9-15(19)13-26-21(27)17-7-5-11-24-20(17)22(26)28/h3-12,25H,2,13H2,1H3 |
| InChIKey | ZUQJZBBJHJDEAX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|