C11H8F2N4O3 — CID 20929982
1-(2,5-difluorophenyl)-3-(2,4-dioxo-1H-pyrimidin-5-yl)urea (PubChem CID 20929982) has the molecular formula C11H8F2N4O3 and a molecular weight of 282.21 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-3-(2,4-dioxo-1H-pyrimidin-5-yl)urea.
| Compound Name | 1-(2,5-difluorophenyl)-3-(2,4-dioxo-1H-pyrimidin-5-yl)urea |
|---|---|
| PubChem CID | 20929982 |
| Molecular Formula | C11H8F2N4O3 |
| Molecular Weight | 282.21 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 1-(2,5-difluorophenyl)-3-(2,4-dioxo-1H-pyrimidin-5-yl)urea |
| SMILES | O=C(Nc1cc(F)ccc1F)Nc1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H8F2N4O3/c12-5-1-2-6(13)7(3-5)15-11(20)16-8-4-14-10(19)17-9(8)18/h1-4H,(H2,15,16,20)(H2,14,17,18,19) |
| InChIKey | SQRRJVLFZRVJDI-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 106.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.21 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |