C24H32FN3O2S — CID 20967928
3-acetamido-N-[3-(dipropylamino)propyl]-4-(4-fluorophenyl)sulfanylbenzamide (PubChem CID 20967928) has the molecular formula C24H32FN3O2S and a molecular weight of 445.60 g/mol. Its IUPAC name is 3-acetamido-N-[3-(dipropylamino)propyl]-4-(4-fluorophenyl)sulfanylbenzamide.
| Compound Name | 3-acetamido-N-[3-(dipropylamino)propyl]-4-(4-fluorophenyl)sulfanylbenzamide |
|---|---|
| PubChem CID | 20967928 |
| Molecular Formula | C24H32FN3O2S |
| Molecular Weight | 445.60 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | 3-acetamido-N-[3-(dipropylamino)propyl]-4-(4-fluorophenyl)sulfanylbenzamide |
| SMILES | CCCN(CCC)CCCNC(=O)c1ccc(Sc2ccc(F)cc2)c(NC(C)=O)c1 |
| InChI | InChI=1S/C24H32FN3O2S/c1-4-14-28(15-5-2)16-6-13-26-24(30)19-7-12-23(22(17-19)27-18(3)29)31-21-10-8-20(25)9-11-21/h7-12,17H,4-6,13-16H2,1-3H3,(H,26,30)(H,27,29) |
| InChIKey | JUGKEMFMHZASGN-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.60 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|