C12H14N4O5 — CID 20977617
2-[(7-nitro-1,2,3-benzoxadiazol-6-yl)amino]hexanoic acid (PubChem CID 20977617) has the molecular formula C12H14N4O5 and a molecular weight of 294.27 g/mol. Its IUPAC name is 2-[(7-nitro-1,2,3-benzoxadiazol-6-yl)amino]hexanoic acid.
| Compound Name | 2-[(7-nitro-1,2,3-benzoxadiazol-6-yl)amino]hexanoic acid |
|---|---|
| PubChem CID | 20977617 |
| Molecular Formula | C12H14N4O5 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 2-[(7-nitro-1,2,3-benzoxadiazol-6-yl)amino]hexanoic acid |
| SMILES | CCCCC(Nc1ccc2nnoc2c1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C12H14N4O5/c1-2-3-4-9(12(17)18)13-7-5-6-8-11(21-15-14-8)10(7)16(19)20/h5-6,9,13H,2-4H2,1H3,(H,17,18) |
| InChIKey | GXSCFCLVYWELEE-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|