C19H23N3O2 — CID 20977795
1-(N-cyclohexyl-C-phenylcarbonimidoyl)-4,5-dimethylpyrazole-3-carboxylic acid (PubChem CID 20977795) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is 1-(N-cyclohexyl-C-phenylcarbonimidoyl)-4,5-dimethylpyrazole-3-carboxylic acid.
| Compound Name | 1-(N-cyclohexyl-C-phenylcarbonimidoyl)-4,5-dimethylpyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 20977795 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 1-(N-cyclohexyl-C-phenylcarbonimidoyl)-4,5-dimethylpyrazole-3-carboxylic acid |
| SMILES | Cc1c(C(=O)O)nn(/C(=N/C2CCCCC2)c2ccccc2)c1C |
| InChI | InChI=1S/C19H23N3O2/c1-13-14(2)22(21-17(13)19(23)24)18(15-9-5-3-6-10-15)20-16-11-7-4-8-12-16/h3,5-6,9-10,16H,4,7-8,11-12H2,1-2H3,(H,23,24)/b20-18+ |
| InChIKey | SJDBVGDJRGRMSG-CZIZESTLSA-N |
| XLogP | 3.83 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|