C19H26O5 — CID 20981624
7-(2-ethoxycarbonyl-2,6-dimethyl-5-oxocyclohexyl)-5-methylhepta-2,4,6-trienoic acid (PubChem CID 20981624) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is 7-(2-ethoxycarbonyl-2,6-dimethyl-5-oxocyclohexyl)-5-methylhepta-2,4,6-trienoic acid.
| Compound Name | 7-(2-ethoxycarbonyl-2,6-dimethyl-5-oxocyclohexyl)-5-methylhepta-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 20981624 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 7-(2-ethoxycarbonyl-2,6-dimethyl-5-oxocyclohexyl)-5-methylhepta-2,4,6-trienoic acid |
| SMILES | CCOC(=O)C1(C)CCC(=O)C(C)C1C=CC(C)=CC=CC(=O)O |
| InChI | InChI=1S/C19H26O5/c1-5-24-18(23)19(4)12-11-16(20)14(3)15(19)10-9-13(2)7-6-8-17(21)22/h6-10,14-15H,5,11-12H2,1-4H3,(H,21,22) |
| InChIKey | DGONINSLAUUELM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|