C12H10N4O2S — CID 20983674
7-(2-amino-1,3-thiazol-4-yl)-1,5-dihydro-1,5-benzodiazepine-2,4-dione (PubChem CID 20983674) has the molecular formula C12H10N4O2S and a molecular weight of 274.31 g/mol. Its IUPAC name is 7-(2-amino-1,3-thiazol-4-yl)-1,5-dihydro-1,5-benzodiazepine-2,4-dione.
| Compound Name | 7-(2-amino-1,3-thiazol-4-yl)-1,5-dihydro-1,5-benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 20983674 |
| Molecular Formula | C12H10N4O2S |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 7-(2-amino-1,3-thiazol-4-yl)-1,5-dihydro-1,5-benzodiazepine-2,4-dione |
| SMILES | Nc1nc(-c2ccc3c(c2)NC(=O)CC(=O)N3)cs1 |
| InChI | InChI=1S/C12H10N4O2S/c13-12-16-9(5-19-12)6-1-2-7-8(3-6)15-11(18)4-10(17)14-7/h1-3,5H,4H2,(H2,13,16)(H,14,17)(H,15,18) |
| InChIKey | XRLKEXBAVZXMMA-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|