C19H28N2O6 — CID 20986226
4-[[3-ethoxy-4-(2-morpholin-4-ylethoxy)phenyl]methylamino]-4-oxobutanoic acid (PubChem CID 20986226) has the molecular formula C19H28N2O6 and a molecular weight of 380.44 g/mol. Its IUPAC name is 4-[[3-ethoxy-4-(2-morpholin-4-ylethoxy)phenyl]methylamino]-4-oxobutanoic acid.
| Compound Name | 4-[[3-ethoxy-4-(2-morpholin-4-ylethoxy)phenyl]methylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 20986226 |
| Molecular Formula | C19H28N2O6 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | 4-[[3-ethoxy-4-(2-morpholin-4-ylethoxy)phenyl]methylamino]-4-oxobutanoic acid |
| SMILES | CCOc1cc(CNC(=O)CCC(=O)O)ccc1OCCN1CCOCC1 |
| InChI | InChI=1S/C19H28N2O6/c1-2-26-17-13-15(14-20-18(22)5-6-19(23)24)3-4-16(17)27-12-9-21-7-10-25-11-8-21/h3-4,13H,2,5-12,14H2,1H3,(H,20,22)(H,23,24) |
| InChIKey | UWIXPLACCSAGLD-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |