C56H59BO18 — CID 21019000
CID 21019000 (PubChem CID 21019000) has the molecular formula C56H59BO18 and a molecular weight of 1030.88 g/mol.
| Compound Name | CID 21019000 |
|---|---|
| PubChem CID | 21019000 |
| Molecular Formula | C56H59BO18 |
| Molecular Weight | 1030.88 g/mol |
| Exact Mass | 1030.38 |
| IUPAC Name | — |
| SMILES | [B]c1c(O)cc(O)c2c1OC(c1ccc(O)c(O)c1)C(OC)C2c1c(OC)cc(OC)c2c1OC(c1ccc(OC)c(OC)c1)C(OC)C2c1c(OC)cc(OC)c2c1OC(c1ccc(OC)c(OC)c1)C(OC)C2 |
| InChI | InChI=1S/C56H59BO18/c1-62-33-16-13-26(19-36(33)65-4)49-41(70-9)21-28-35(64-3)23-38(67-6)43(52(28)73-49)47-45-40(69-8)24-39(68-7)44(53(45)74-51(56(47)72-11)27-14-17-34(63-2)37(20-27)66-5)46-42-31(60)22-32(61)48(57)54(42)75-50(55(46)71-10)25-12-15-29(58)30(59)18-25/h12-20,22-24,41,46-47,49-51,55-56,58-61H,21H2,1-11H3 |
| InChIKey | ILXIGBAUJLJCCS-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 210.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 75 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1030.88 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|