C19H24F2N2O7 — CID 21021913
(E)-but-2-enedioic acid;[4-(difluoromethoxy)phenyl]methyl (2R)-2-ethylpiperazine-1-carboxylate (PubChem CID 21021913) has the molecular formula C19H24F2N2O7 and a molecular weight of 430.40 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;[4-(difluoromethoxy)phenyl]methyl (2R)-2-ethylpiperazine-1-carboxylate.
| Compound Name | (E)-but-2-enedioic acid;[4-(difluoromethoxy)phenyl]methyl (2R)-2-ethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 21021913 |
| Molecular Formula | C19H24F2N2O7 |
| Molecular Weight | 430.40 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | (E)-but-2-enedioic acid;[4-(difluoromethoxy)phenyl]methyl (2R)-2-ethylpiperazine-1-carboxylate |
| SMILES | CC[C@@H]1CNCCN1C(=O)OCc1ccc(OC(F)F)cc1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C15H20F2N2O3.C4H4O4/c1-2-12-9-18-7-8-19(12)15(20)21-10-11-3-5-13(6-4-11)22-14(16)17;5-3(6)1-2-4(7)8/h3-6,12,14,18H,2,7-10H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+/t12-;/m1./s1 |
| InChIKey | OFDTUWZWYFHFDN-SNXORLAUSA-N |
| XLogP | 2.32 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.40 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|