C40H22F12N4O8 — CID 21022185
2,6-bis[5-[2-(3-amino-4-hydroxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyphenyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 21022185) has the molecular formula C40H22F12N4O8 and a molecular weight of 914.61 g/mol. Its IUPAC name is 2,6-bis[5-[2-(3-amino-4-hydroxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyphenyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 2,6-bis[5-[2-(3-amino-4-hydroxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyphenyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 21022185 |
| Molecular Formula | C40H22F12N4O8 |
| Molecular Weight | 914.61 g/mol |
| Exact Mass | 914.12 |
| IUPAC Name | 2,6-bis[5-[2-(3-amino-4-hydroxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyphenyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | Nc1cc(C(c2ccc(O)c(-n3c(=O)c4cc5c(=O)n(-c6cc(C(c7ccc(O)c(N)c7)(C(F)(F)F)C(F)(F)F)ccc6O)c(=O)c5cc4c3=O)c2)(C(F)(F)F)C(F)(F)F)ccc1O |
| InChI | InChI=1S/C40H22F12N4O8/c41-37(42,43)35(38(44,45)46,15-1-5-27(57)23(53)9-15)17-3-7-29(59)25(11-17)55-31(61)19-13-21-22(14-20(19)32(55)62)34(64)56(33(21)63)26-12-18(4-8-30(26)60)36(39(47,48)49,40(50,51)52)16-2-6-28(58)24(54)10-16/h1-14,57-60H,53-54H2 |
| InChIKey | OXNDFWZBHHRURJ-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 211.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 64 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 914.61 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|