About 4-(3,4-dimethylphenyl)-1,2-dimethylbenzene
4-(3,4-dimethylphenyl)-1,2-dimethylbenzene (PubChem CID 21029) has the molecular formula C16H18
and a molecular weight of 210.32 g/mol. Its IUPAC name is 4-(3,4-dimethylphenyl)-1,2-dimethylbenzene.
Molecular Properties
| Compound Name | 4-(3,4-dimethylphenyl)-1,2-dimethylbenzene |
| PubChem CID | 21029 |
| Molecular Formula | C16H18 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 4-(3,4-dimethylphenyl)-1,2-dimethylbenzene |
| SMILES | Cc1ccc(-c2ccc(C)c(C)c2)cc1C |
| InChI | InChI=1S/C16H18/c1-11-5-7-15(9-13(11)3)16-8-6-12(2)14(4)10-16/h5-10H,1-4H3 |
| InChIKey | YXBIAYXZUDJVEB-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-(3,4-dimethylphenyl)-1,2-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-dimethylphenyl)-1,2-dimethylbenzene?
The IUPAC name of 4-(3,4-dimethylphenyl)-1,2-dimethylbenzene (CID 21029) is 4-(3,4-dimethylphenyl)-1,2-dimethylbenzene.
What is the SMILES notation for 4-(3,4-dimethylphenyl)-1,2-dimethylbenzene?
The canonical SMILES for 4-(3,4-dimethylphenyl)-1,2-dimethylbenzene is Cc1ccc(-c2ccc(C)c(C)c2)cc1C.
What is the InChIKey of 4-(3,4-dimethylphenyl)-1,2-dimethylbenzene?
The InChIKey is YXBIAYXZUDJVEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18/c1-11-5-7-15(9-13(11)3)16-8-6-12(2)14(4)10-16/h5-10H,1-4H3.
What are the key properties of 4-(3,4-dimethylphenyl)-1,2-dimethylbenzene?
4-(3,4-dimethylphenyl)-1,2-dimethylbenzene has a molecular weight of 210.32 g/mol, XLogP of 4.59, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dimethylphenyl)-1,2-dimethylbenzene is sourced from PubChem (CID 21029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).