About CID 21029276
CID 21029276 (PubChem CID 21029276) has the molecular formula C4H6BNO3
and a molecular weight of 126.91 g/mol.
Molecular Properties
| Compound Name | CID 21029276 |
| PubChem CID | 21029276 |
| Molecular Formula | C4H6BNO3 |
| Molecular Weight | 126.91 g/mol |
| Exact Mass | 127.04 |
| IUPAC Name | — |
| SMILES | [B]N(CC=O)CC(=O)O |
| InChI | InChI=1S/C4H6BNO3/c5-6(1-2-7)3-4(8)9/h2H,1,3H2,(H,8,9) |
| InChIKey | GYVOSRDTSZIFGU-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.91 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 21029276 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 21029276?
The IUPAC name of CID 21029276 (CID 21029276) is not available.
What is the SMILES notation for CID 21029276?
The canonical SMILES for CID 21029276 is [B]N(CC=O)CC(=O)O.
What is the InChIKey of CID 21029276?
The InChIKey is GYVOSRDTSZIFGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6BNO3/c5-6(1-2-7)3-4(8)9/h2H,1,3H2,(H,8,9).
What are the key properties of CID 21029276?
CID 21029276 has a molecular weight of 126.91 g/mol, XLogP of -1.34, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 21029276 is sourced from PubChem (CID 21029276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).