C25H43NO3S — CID 21038221
3-[[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S)-3-hydroxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]methylsulfanyl]-N-tert-butyl-N-methylpropanamide (PubChem CID 21038221) has the molecular formula C25H43NO3S and a molecular weight of 437.69 g/mol. Its IUPAC name is 3-[[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S)-3-hydroxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]methylsulfanyl]-N-tert-butyl-N-methylpropanamide.
| Compound Name | 3-[[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S)-3-hydroxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]methylsulfanyl]-N-tert-butyl-N-methylpropanamide |
|---|---|
| PubChem CID | 21038221 |
| Molecular Formula | C25H43NO3S |
| Molecular Weight | 437.69 g/mol |
| Exact Mass | 437.30 |
| IUPAC Name | 3-[[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S)-3-hydroxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]methylsulfanyl]-N-tert-butyl-N-methylpropanamide |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@H]2CC(CSCCC(=O)N(C)C(C)(C)C)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C25H43NO3S/c1-6-7-8-9-20(27)10-11-21-22-15-18(14-19(22)16-23(21)28)17-30-13-12-24(29)26(5)25(2,3)4/h10-11,14,19-23,27-28H,6-9,12-13,15-17H2,1-5H3/b11-10+/t19-,20-,21+,22-,23+/m0/s1 |
| InChIKey | WLUHUAVWPGGMEC-BVYQWZDTSA-N |
| XLogP | 4.81 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.69 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|