C36H36N6O4Si — CID 21041974
methyl 3-[20-imidazol-1-yl-15-(3-methoxy-3-oxopropyl)-10-(2-trimethylsilylethynyl)-21,24-dihydroporphyrin-5-yl]propanoate (PubChem CID 21041974) has the molecular formula C36H36N6O4Si and a molecular weight of 644.81 g/mol. Its IUPAC name is methyl 3-[20-imidazol-1-yl-15-(3-methoxy-3-oxopropyl)-10-(2-trimethylsilylethynyl)-21,24-dihydroporphyrin-5-yl]propanoate.
| Compound Name | methyl 3-[20-imidazol-1-yl-15-(3-methoxy-3-oxopropyl)-10-(2-trimethylsilylethynyl)-21,24-dihydroporphyrin-5-yl]propanoate |
|---|---|
| PubChem CID | 21041974 |
| Molecular Formula | C36H36N6O4Si |
| Molecular Weight | 644.81 g/mol |
| Exact Mass | 644.26 |
| IUPAC Name | methyl 3-[20-imidazol-1-yl-15-(3-methoxy-3-oxopropyl)-10-(2-trimethylsilylethynyl)-21,24-dihydroporphyrin-5-yl]propanoate |
| SMILES | COC(=O)CCc1c2nc(c(C#C[Si](C)(C)C)c3nc(c(CCC(=O)OC)c4ccc([nH]4)c(-n4ccnc4)c4ccc1[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C36H36N6O4Si/c1-45-34(43)16-6-23-26-8-10-30(38-26)25(18-21-47(3,4)5)31-11-9-27(39-31)24(7-17-35(44)46-2)29-13-15-33(41-29)36(42-20-19-37-22-42)32-14-12-28(23)40-32/h8-15,19-20,22,40-41H,6-7,16-17H2,1-5H3/b26-23-,27-24-,28-23-,29-24-,30-25-,31-25-,36-32+,36-33+ |
| InChIKey | QSZBWUCMYVILSA-YOFAIFQKSA-N |
| XLogP | 6.28 |
| TPSA | 127.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.81 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|