C32H31NO9P+ — CID 21043500
[(Z)-1-[9-(4-carboxy-2,6-dimethylphenoxy)carbonyl-10-methyl-9,9a-dihydro-4aH-acridin-3-yl]-2-(4-hydroxyphenyl)ethenoxy]-trihydroxyphosphanium (PubChem CID 21043500) has the molecular formula C32H31NO9P+ and a molecular weight of 604.57 g/mol. Its IUPAC name is [(Z)-1-[9-(4-carboxy-2,6-dimethylphenoxy)carbonyl-10-methyl-9,9a-dihydro-4aH-acridin-3-yl]-2-(4-hydroxyphenyl)ethenoxy]-trihydroxyphosphanium.
| Compound Name | [(Z)-1-[9-(4-carboxy-2,6-dimethylphenoxy)carbonyl-10-methyl-9,9a-dihydro-4aH-acridin-3-yl]-2-(4-hydroxyphenyl)ethenoxy]-trihydroxyphosphanium |
|---|---|
| PubChem CID | 21043500 |
| Molecular Formula | C32H31NO9P+ |
| Molecular Weight | 604.57 g/mol |
| Exact Mass | 604.17 |
| IUPAC Name | [(Z)-1-[9-(4-carboxy-2,6-dimethylphenoxy)carbonyl-10-methyl-9,9a-dihydro-4aH-acridin-3-yl]-2-(4-hydroxyphenyl)ethenoxy]-trihydroxyphosphanium |
| SMILES | Cc1cc(C(=O)O)cc(C)c1OC(=O)C1c2ccccc2N(C)C2C=C(/C(=C/c3ccc(O)cc3)O[P+](O)(O)O)C=CC12 |
| InChI | InChI=1S/C32H30NO9P/c1-18-14-22(31(35)36)15-19(2)30(18)41-32(37)29-24-6-4-5-7-26(24)33(3)27-17-21(10-13-25(27)29)28(42-43(38,39)40)16-20-8-11-23(34)12-9-20/h4-17,25,27,29,38-40H,1-3H3,(H-,34,35,36)/p+1/b28-16- |
| InChIKey | IRGCUCVOCCDCDR-NTFVMDSBSA-O |
| XLogP | 5.04 |
| TPSA | 156.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.57 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|