C43H41NO8S — CID 173123743
4-[9-(2,6-dimethyl-4-phenylmethoxycarbonylphenoxy)carbonyl-3-[2-(4-methoxyphenyl)ethenyl]-9H-acridin-10-yl]butane-1-sulfonic acid (PubChem CID 173123743) has the molecular formula C43H41NO8S and a molecular weight of 731.87 g/mol. Its IUPAC name is 4-[9-(2,6-dimethyl-4-phenylmethoxycarbonylphenoxy)carbonyl-3-[2-(4-methoxyphenyl)ethenyl]-9H-acridin-10-yl]butane-1-sulfonic acid.
| Compound Name | 4-[9-(2,6-dimethyl-4-phenylmethoxycarbonylphenoxy)carbonyl-3-[2-(4-methoxyphenyl)ethenyl]-9H-acridin-10-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 173123743 |
| Molecular Formula | C43H41NO8S |
| Molecular Weight | 731.87 g/mol |
| Exact Mass | 731.26 |
| IUPAC Name | 4-[9-(2,6-dimethyl-4-phenylmethoxycarbonylphenoxy)carbonyl-3-[2-(4-methoxyphenyl)ethenyl]-9H-acridin-10-yl]butane-1-sulfonic acid |
| SMILES | COc1ccc(C=Cc2ccc3c(c2)N(CCCCS(=O)(=O)O)c2ccccc2C3C(=O)Oc2c(C)cc(C(=O)OCc3ccccc3)cc2C)cc1 |
| InChI | InChI=1S/C43H41NO8S/c1-29-25-34(42(45)51-28-33-11-5-4-6-12-33)26-30(2)41(29)52-43(46)40-36-13-7-8-14-38(36)44(23-9-10-24-53(47,48)49)39-27-32(19-22-37(39)40)16-15-31-17-20-35(50-3)21-18-31/h4-8,11-22,25-27,40H,9-10,23-24,28H2,1-3H3,(H,47,48,49) |
| InChIKey | AAWACECBJZMRCO-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.87 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|