C31H38N2O9 — CID 21046539
ethyl 6,8-dimethoxy-4,4-dimethyl-5-[[5-[(2,4,6-trimethoxyphenyl)carbamoyl]furan-2-yl]methyl]-2,3-dihydroquinoline-1-carboxylate (PubChem CID 21046539) has the molecular formula C31H38N2O9 and a molecular weight of 582.65 g/mol. Its IUPAC name is ethyl 6,8-dimethoxy-4,4-dimethyl-5-[[5-[(2,4,6-trimethoxyphenyl)carbamoyl]furan-2-yl]methyl]-2,3-dihydroquinoline-1-carboxylate.
| Compound Name | ethyl 6,8-dimethoxy-4,4-dimethyl-5-[[5-[(2,4,6-trimethoxyphenyl)carbamoyl]furan-2-yl]methyl]-2,3-dihydroquinoline-1-carboxylate |
|---|---|
| PubChem CID | 21046539 |
| Molecular Formula | C31H38N2O9 |
| Molecular Weight | 582.65 g/mol |
| Exact Mass | 582.26 |
| IUPAC Name | ethyl 6,8-dimethoxy-4,4-dimethyl-5-[[5-[(2,4,6-trimethoxyphenyl)carbamoyl]furan-2-yl]methyl]-2,3-dihydroquinoline-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(C)(C)c2c(Cc3ccc(C(=O)Nc4c(OC)cc(OC)cc4OC)o3)c(OC)cc(OC)c21 |
| InChI | InChI=1S/C31H38N2O9/c1-9-41-30(35)33-13-12-31(2,3)26-20(22(37-5)17-25(40-8)28(26)33)14-18-10-11-21(42-18)29(34)32-27-23(38-6)15-19(36-4)16-24(27)39-7/h10-11,15-17H,9,12-14H2,1-8H3,(H,32,34) |
| InChIKey | RXNRADFJTDUYNY-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 117.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.65 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |