C9H15N3O4S — CID 21048641
2,4-dioxo-N-pentyl-1H-pyrimidine-5-sulfonamide (PubChem CID 21048641) has the molecular formula C9H15N3O4S and a molecular weight of 261.30 g/mol. Its IUPAC name is 2,4-dioxo-N-pentyl-1H-pyrimidine-5-sulfonamide.
| Compound Name | 2,4-dioxo-N-pentyl-1H-pyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 21048641 |
| Molecular Formula | C9H15N3O4S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 2,4-dioxo-N-pentyl-1H-pyrimidine-5-sulfonamide |
| SMILES | CCCCCNS(=O)(=O)c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H15N3O4S/c1-2-3-4-5-11-17(15,16)7-6-10-9(14)12-8(7)13/h6,11H,2-5H2,1H3,(H2,10,12,13,14) |
| InChIKey | JSPYKRUYBHFHLY-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|