C14H25N3O6S — CID 21053788
(2R)-2-amino-2-(2,7-dioxoazepan-1-yl)-3-sulfanylpropanoic acid;(2S)-2-amino-3-methylbutanoic acid (PubChem CID 21053788) has the molecular formula C14H25N3O6S and a molecular weight of 363.44 g/mol. Its IUPAC name is (2R)-2-amino-2-(2,7-dioxoazepan-1-yl)-3-sulfanylpropanoic acid;(2S)-2-amino-3-methylbutanoic acid.
| Compound Name | (2R)-2-amino-2-(2,7-dioxoazepan-1-yl)-3-sulfanylpropanoic acid;(2S)-2-amino-3-methylbutanoic acid |
|---|---|
| PubChem CID | 21053788 |
| Molecular Formula | C14H25N3O6S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | (2R)-2-amino-2-(2,7-dioxoazepan-1-yl)-3-sulfanylpropanoic acid;(2S)-2-amino-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](N)C(=O)O.N[C@](CS)(C(=O)O)N1C(=O)CCCCC1=O |
| InChI | InChI=1S/C9H14N2O4S.C5H11NO2/c10-9(5-16,8(14)15)11-6(12)3-1-2-4-7(11)13;1-3(2)4(6)5(7)8/h16H,1-5,10H2,(H,14,15);3-4H,6H2,1-2H3,(H,7,8)/t9-;4-/m00/s1 |
| InChIKey | KZHDUXSVTYONRZ-AGAVTAENSA-N |
| XLogP | -0.36 |
| TPSA | 164.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|