C27H48I2N6O11 — CID 21059341
N',N'-bis[2-[2-[2-[2-[(2-iodoacetyl)amino]ethoxy]ethoxy]ethylamino]-2-oxoethyl]-N-(2-methoxyethyl)butanediamide (PubChem CID 21059341) has the molecular formula C27H48I2N6O11 and a molecular weight of 886.52 g/mol. Its IUPAC name is N',N'-bis[2-[2-[2-[2-[(2-iodoacetyl)amino]ethoxy]ethoxy]ethylamino]-2-oxoethyl]-N-(2-methoxyethyl)butanediamide.
| Compound Name | N',N'-bis[2-[2-[2-[2-[(2-iodoacetyl)amino]ethoxy]ethoxy]ethylamino]-2-oxoethyl]-N-(2-methoxyethyl)butanediamide |
|---|---|
| PubChem CID | 21059341 |
| Molecular Formula | C27H48I2N6O11 |
| Molecular Weight | 886.52 g/mol |
| Exact Mass | 886.15 |
| IUPAC Name | N',N'-bis[2-[2-[2-[2-[(2-iodoacetyl)amino]ethoxy]ethoxy]ethylamino]-2-oxoethyl]-N-(2-methoxyethyl)butanediamide |
| SMILES | COCCNC(=O)CCC(=O)N(CC(=O)NCCOCCOCCNC(=O)CI)CC(=O)NCCOCCOCCNC(=O)CI |
| InChI | InChI=1S/C27H48I2N6O11/c1-42-9-4-30-22(36)2-3-27(41)35(20-25(39)33-7-12-45-16-14-43-10-5-31-23(37)18-28)21-26(40)34-8-13-46-17-15-44-11-6-32-24(38)19-29/h2-21H2,1H3,(H,30,36)(H,31,37)(H,32,38)(H,33,39)(H,34,40) |
| InChIKey | MVXWXCCZVRDNPZ-UHFFFAOYSA-N |
| XLogP | -2.24 |
| TPSA | 211.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 886.52 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|