C32H31IN2O3 — CID 21064785
N-[4-[[6,7-bis(phenylmethoxy)-1,2,3,4-tetrahydroisoquinolin-1-yl]methyl]-2-iodophenyl]acetamide (PubChem CID 21064785) has the molecular formula C32H31IN2O3 and a molecular weight of 618.52 g/mol. Its IUPAC name is N-[4-[[6,7-bis(phenylmethoxy)-1,2,3,4-tetrahydroisoquinolin-1-yl]methyl]-2-iodophenyl]acetamide.
| Compound Name | N-[4-[[6,7-bis(phenylmethoxy)-1,2,3,4-tetrahydroisoquinolin-1-yl]methyl]-2-iodophenyl]acetamide |
|---|---|
| PubChem CID | 21064785 |
| Molecular Formula | C32H31IN2O3 |
| Molecular Weight | 618.52 g/mol |
| Exact Mass | 618.14 |
| IUPAC Name | N-[4-[[6,7-bis(phenylmethoxy)-1,2,3,4-tetrahydroisoquinolin-1-yl]methyl]-2-iodophenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(CC2NCCc3cc(OCc4ccccc4)c(OCc4ccccc4)cc32)cc1I |
| InChI | InChI=1S/C32H31IN2O3/c1-22(36)35-29-13-12-25(16-28(29)33)17-30-27-19-32(38-21-24-10-6-3-7-11-24)31(18-26(27)14-15-34-30)37-20-23-8-4-2-5-9-23/h2-13,16,18-19,30,34H,14-15,17,20-21H2,1H3,(H,35,36) |
| InChIKey | NHCIDPRBZXXEEJ-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.52 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|