C22H36N4O5S — CID 21069204
tert-butyl 4-[4-(5-butylpyrazin-2-yl)piperazin-1-yl]sulfonyloxane-4-carboxylate (PubChem CID 21069204) has the molecular formula C22H36N4O5S and a molecular weight of 468.62 g/mol. Its IUPAC name is tert-butyl 4-[4-(5-butylpyrazin-2-yl)piperazin-1-yl]sulfonyloxane-4-carboxylate.
| Compound Name | tert-butyl 4-[4-(5-butylpyrazin-2-yl)piperazin-1-yl]sulfonyloxane-4-carboxylate |
|---|---|
| PubChem CID | 21069204 |
| Molecular Formula | C22H36N4O5S |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | tert-butyl 4-[4-(5-butylpyrazin-2-yl)piperazin-1-yl]sulfonyloxane-4-carboxylate |
| SMILES | CCCCc1cnc(N2CCN(S(=O)(=O)C3(C(=O)OC(C)(C)C)CCOCC3)CC2)cn1 |
| InChI | InChI=1S/C22H36N4O5S/c1-5-6-7-18-16-24-19(17-23-18)25-10-12-26(13-11-25)32(28,29)22(8-14-30-15-9-22)20(27)31-21(2,3)4/h16-17H,5-15H2,1-4H3 |
| InChIKey | RZTQOPFKQRNIQL-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 101.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |