C18H28N4O5S — CID 21069025
4-[4-(5-butylpyrazin-2-yl)piperazin-1-yl]sulfonyloxane-4-carboxylic acid (PubChem CID 21069025) has the molecular formula C18H28N4O5S and a molecular weight of 412.51 g/mol. Its IUPAC name is 4-[4-(5-butylpyrazin-2-yl)piperazin-1-yl]sulfonyloxane-4-carboxylic acid.
| Compound Name | 4-[4-(5-butylpyrazin-2-yl)piperazin-1-yl]sulfonyloxane-4-carboxylic acid |
|---|---|
| PubChem CID | 21069025 |
| Molecular Formula | C18H28N4O5S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 4-[4-(5-butylpyrazin-2-yl)piperazin-1-yl]sulfonyloxane-4-carboxylic acid |
| SMILES | CCCCc1cnc(N2CCN(S(=O)(=O)C3(C(=O)O)CCOCC3)CC2)cn1 |
| InChI | InChI=1S/C18H28N4O5S/c1-2-3-4-15-13-20-16(14-19-15)21-7-9-22(10-8-21)28(25,26)18(17(23)24)5-11-27-12-6-18/h13-14H,2-12H2,1H3,(H,23,24) |
| InChIKey | BYWVYSUMSUFKOF-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |