C22H31F5N4O5S — CID 21069272
tert-butyl 4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]piperazin-1-yl]sulfonyloxane-4-carboxylate (PubChem CID 21069272) has the molecular formula C22H31F5N4O5S and a molecular weight of 558.57 g/mol. Its IUPAC name is tert-butyl 4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]piperazin-1-yl]sulfonyloxane-4-carboxylate.
| Compound Name | tert-butyl 4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]piperazin-1-yl]sulfonyloxane-4-carboxylate |
|---|---|
| PubChem CID | 21069272 |
| Molecular Formula | C22H31F5N4O5S |
| Molecular Weight | 558.57 g/mol |
| Exact Mass | 558.19 |
| IUPAC Name | tert-butyl 4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]piperazin-1-yl]sulfonyloxane-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(S(=O)(=O)N2CCN(c3cnc(CCC(F)(F)C(F)(F)F)cn3)CC2)CCOCC1 |
| InChI | InChI=1S/C22H31F5N4O5S/c1-19(2,3)36-18(32)20(6-12-35-13-7-20)37(33,34)31-10-8-30(9-11-31)17-15-28-16(14-29-17)4-5-21(23,24)22(25,26)27/h14-15H,4-13H2,1-3H3 |
| InChIKey | VWIJUVFJNSWTQR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 101.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.57 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|