3-oxo-3-(3,3,4,4,4-pentafluorobutylamino)propanoic acid

C7H8F5NO3 — CID 21072536

IUPAC3-oxo-3-(3,3,4,4,4-pentafluorobutylamino)propanoic acid
SMILESO=C(O)CC(=O)NCCC(F)(F)C(F)(F)F
InChIInChI=1S/C7H8F5NO3/c8-6(9,7(10,11)12)1-2-13-4(14)3-5(15)16/h1-3H2,(H,13,14)(H,15,16)
InChIKeySLPCILILCDTUKI-UHFFFAOYSA-N
MW249.13 g/mol
LogP1.16
Rot. Bonds5

About 3-oxo-3-(3,3,4,4,4-pentafluorobutylamino)propanoic acid

3-oxo-3-(3,3,4,4,4-pentafluorobutylamino)propanoic acid (PubChem CID 21072536) has the molecular formula C7H8F5NO3 and a molecular weight of 249.13 g/mol. Its IUPAC name is 3-oxo-3-(3,3,4,4,4-pentafluorobutylamino)propanoic acid.

Molecular Properties

Compound Name3-oxo-3-(3,3,4,4,4-pentafluorobutylamino)propanoic acid
PubChem CID21072536
Molecular FormulaC7H8F5NO3
Molecular Weight249.13 g/mol
Exact Mass249.04
IUPAC Name3-oxo-3-(3,3,4,4,4-pentafluorobutylamino)propanoic acid
SMILESO=C(O)CC(=O)NCCC(F)(F)C(F)(F)F
InChIInChI=1S/C7H8F5NO3/c8-6(9,7(10,11)12)1-2-13-4(14)3-5(15)16/h1-3H2,(H,13,14)(H,15,16)
InChIKeySLPCILILCDTUKI-UHFFFAOYSA-N
XLogP1.16
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.13
LogP ≤ 51.16
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}

Analyze 3-oxo-3-(3,3,4,4,4-pentafluorobutylamino)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-oxo-3-(3,3,4,4,4-pentafluorobutylamino)propanoic acid?
The IUPAC name of 3-oxo-3-(3,3,4,4,4-pentafluorobutylamino)propanoic acid (CID 21072536) is 3-oxo-3-(3,3,4,4,4-pentafluorobutylamino)propanoic acid.
What is the SMILES notation for 3-oxo-3-(3,3,4,4,4-pentafluorobutylamino)propanoic acid?
The canonical SMILES for 3-oxo-3-(3,3,4,4,4-pentafluorobutylamino)propanoic acid is O=C(O)CC(=O)NCCC(F)(F)C(F)(F)F.
What is the InChIKey of 3-oxo-3-(3,3,4,4,4-pentafluorobutylamino)propanoic acid?
The InChIKey is SLPCILILCDTUKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F5NO3/c8-6(9,7(10,11)12)1-2-13-4(14)3-5(15)16/h1-3H2,(H,13,14)(H,15,16).
What are the key properties of 3-oxo-3-(3,3,4,4,4-pentafluorobutylamino)propanoic acid?
3-oxo-3-(3,3,4,4,4-pentafluorobutylamino)propanoic acid has a molecular weight of 249.13 g/mol, XLogP of 1.16, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxo-3-(3,3,4,4,4-pentafluorobutylamino)propanoic acid is sourced from PubChem (CID 21072536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).