C7H8F5NO3 — CID 21072536
3-oxo-3-(3,3,4,4,4-pentafluorobutylamino)propanoic acid (PubChem CID 21072536) has the molecular formula C7H8F5NO3 and a molecular weight of 249.13 g/mol. Its IUPAC name is 3-oxo-3-(3,3,4,4,4-pentafluorobutylamino)propanoic acid.
| Compound Name | 3-oxo-3-(3,3,4,4,4-pentafluorobutylamino)propanoic acid |
|---|---|
| PubChem CID | 21072536 |
| Molecular Formula | C7H8F5NO3 |
| Molecular Weight | 249.13 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | 3-oxo-3-(3,3,4,4,4-pentafluorobutylamino)propanoic acid |
| SMILES | O=C(O)CC(=O)NCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H8F5NO3/c8-6(9,7(10,11)12)1-2-13-4(14)3-5(15)16/h1-3H2,(H,13,14)(H,15,16) |
| InChIKey | SLPCILILCDTUKI-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.13 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|