C18H13N3O3S3 — CID 21081352
4-phenoxy-N-(3-thiophen-2-yl-1,2,4-thiadiazol-5-yl)benzenesulfonamide (PubChem CID 21081352) has the molecular formula C18H13N3O3S3 and a molecular weight of 415.52 g/mol. Its IUPAC name is 4-phenoxy-N-(3-thiophen-2-yl-1,2,4-thiadiazol-5-yl)benzenesulfonamide.
| Compound Name | 4-phenoxy-N-(3-thiophen-2-yl-1,2,4-thiadiazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 21081352 |
| Molecular Formula | C18H13N3O3S3 |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.01 |
| IUPAC Name | 4-phenoxy-N-(3-thiophen-2-yl-1,2,4-thiadiazol-5-yl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1nc(-c2cccs2)ns1)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C18H13N3O3S3/c22-27(23,21-18-19-17(20-26-18)16-7-4-12-25-16)15-10-8-14(9-11-15)24-13-5-2-1-3-6-13/h1-12H,(H,19,20,21) |
| InChIKey | BWLKIFFSFUHAKC-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |