C15H13N3O4S2 — CID 21081391
N-(3-methoxy-1,2,4-thiadiazol-5-yl)-4-phenoxybenzenesulfonamide (PubChem CID 21081391) has the molecular formula C15H13N3O4S2 and a molecular weight of 363.42 g/mol. Its IUPAC name is N-(3-methoxy-1,2,4-thiadiazol-5-yl)-4-phenoxybenzenesulfonamide.
| Compound Name | N-(3-methoxy-1,2,4-thiadiazol-5-yl)-4-phenoxybenzenesulfonamide |
|---|---|
| PubChem CID | 21081391 |
| Molecular Formula | C15H13N3O4S2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | N-(3-methoxy-1,2,4-thiadiazol-5-yl)-4-phenoxybenzenesulfonamide |
| SMILES | COc1nsc(NS(=O)(=O)c2ccc(Oc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C15H13N3O4S2/c1-21-14-16-15(23-17-14)18-24(19,20)13-9-7-12(8-10-13)22-11-5-3-2-4-6-11/h2-10H,1H3,(H,16,17,18) |
| InChIKey | YFFGSCMGOATNRG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |