C11H11N2O3- — CID 21083260
2-(4-oxo-2,3-dihydro-1H-1,5-benzodiazepin-5-yl)acetate (PubChem CID 21083260) has the molecular formula C11H11N2O3- and a molecular weight of 219.22 g/mol. Its IUPAC name is 2-(4-oxo-2,3-dihydro-1H-1,5-benzodiazepin-5-yl)acetate.
| Compound Name | 2-(4-oxo-2,3-dihydro-1H-1,5-benzodiazepin-5-yl)acetate |
|---|---|
| PubChem CID | 21083260 |
| Molecular Formula | C11H11N2O3- |
| Molecular Weight | 219.22 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 2-(4-oxo-2,3-dihydro-1H-1,5-benzodiazepin-5-yl)acetate |
| SMILES | O=C([O-])CN1C(=O)CCNc2ccccc21 |
| InChI | InChI=1S/C11H12N2O3/c14-10-5-6-12-8-3-1-2-4-9(8)13(10)7-11(15)16/h1-4,12H,5-7H2,(H,15,16)/p-1 |
| InChIKey | XMCDEWPKRTYUFT-UHFFFAOYSA-M |
| XLogP | -0.41 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.22 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |