C24H21Cl2F3N4O4 — CID 21093841
2-chloro-N-[[3-(4-chlorophenyl)oxan-3-yl]methyl]-5-[3,5-dioxo-4-(2,2,2-trifluoroethyl)-1,2,4-triazin-2-yl]benzamide (PubChem CID 21093841) has the molecular formula C24H21Cl2F3N4O4 and a molecular weight of 557.36 g/mol. Its IUPAC name is 2-chloro-N-[[3-(4-chlorophenyl)oxan-3-yl]methyl]-5-[3,5-dioxo-4-(2,2,2-trifluoroethyl)-1,2,4-triazin-2-yl]benzamide.
| Compound Name | 2-chloro-N-[[3-(4-chlorophenyl)oxan-3-yl]methyl]-5-[3,5-dioxo-4-(2,2,2-trifluoroethyl)-1,2,4-triazin-2-yl]benzamide |
|---|---|
| PubChem CID | 21093841 |
| Molecular Formula | C24H21Cl2F3N4O4 |
| Molecular Weight | 557.36 g/mol |
| Exact Mass | 556.09 |
| IUPAC Name | 2-chloro-N-[[3-(4-chlorophenyl)oxan-3-yl]methyl]-5-[3,5-dioxo-4-(2,2,2-trifluoroethyl)-1,2,4-triazin-2-yl]benzamide |
| SMILES | O=C(NCC1(c2ccc(Cl)cc2)CCCOC1)c1cc(-n2ncc(=O)n(CC(F)(F)F)c2=O)ccc1Cl |
| InChI | InChI=1S/C24H21Cl2F3N4O4/c25-16-4-2-15(3-5-16)23(8-1-9-37-14-23)12-30-21(35)18-10-17(6-7-19(18)26)33-22(36)32(13-24(27,28)29)20(34)11-31-33/h2-7,10-11H,1,8-9,12-14H2,(H,30,35) |
| InChIKey | LUGKRVGYDFLEFM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.36 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |