C21H27ClN4O2 — CID 21101946
tert-butyl 4-[7-chloro-2-(cyclopropylamino)quinolin-4-yl]piperazine-1-carboxylate (PubChem CID 21101946) has the molecular formula C21H27ClN4O2 and a molecular weight of 402.93 g/mol. Its IUPAC name is tert-butyl 4-[7-chloro-2-(cyclopropylamino)quinolin-4-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[7-chloro-2-(cyclopropylamino)quinolin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 21101946 |
| Molecular Formula | C21H27ClN4O2 |
| Molecular Weight | 402.93 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | tert-butyl 4-[7-chloro-2-(cyclopropylamino)quinolin-4-yl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2cc(NC3CC3)nc3cc(Cl)ccc23)CC1 |
| InChI | InChI=1S/C21H27ClN4O2/c1-21(2,3)28-20(27)26-10-8-25(9-11-26)18-13-19(23-15-5-6-15)24-17-12-14(22)4-7-16(17)18/h4,7,12-13,15H,5-6,8-11H2,1-3H3,(H,23,24) |
| InChIKey | XHKZMWBSVSVSPQ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.93 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |