C17H22O3SSi — CID 21102862
[benzyl(dimethyl)silyl] 3,5-dimethylbenzenesulfonate (PubChem CID 21102862) has the molecular formula C17H22O3SSi and a molecular weight of 334.51 g/mol. Its IUPAC name is [benzyl(dimethyl)silyl] 3,5-dimethylbenzenesulfonate.
| Compound Name | [benzyl(dimethyl)silyl] 3,5-dimethylbenzenesulfonate |
|---|---|
| PubChem CID | 21102862 |
| Molecular Formula | C17H22O3SSi |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | [benzyl(dimethyl)silyl] 3,5-dimethylbenzenesulfonate |
| SMILES | Cc1cc(C)cc(S(=O)(=O)O[Si](C)(C)Cc2ccccc2)c1 |
| InChI | InChI=1S/C17H22O3SSi/c1-14-10-15(2)12-17(11-14)21(18,19)20-22(3,4)13-16-8-6-5-7-9-16/h5-12H,13H2,1-4H3 |
| InChIKey | JVLGPKXZADXCOA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|