C6H17NO5P2S — CID 21113795
(hydroxy-propan-2-ylimino-propan-2-ylsulfanyl-λ5-phosphanyl) dihydrogen phosphate (PubChem CID 21113795) has the molecular formula C6H17NO5P2S and a molecular weight of 277.22 g/mol. Its IUPAC name is (hydroxy-propan-2-ylimino-propan-2-ylsulfanyl-λ5-phosphanyl) dihydrogen phosphate.
| Compound Name | (hydroxy-propan-2-ylimino-propan-2-ylsulfanyl-λ5-phosphanyl) dihydrogen phosphate |
|---|---|
| PubChem CID | 21113795 |
| Molecular Formula | C6H17NO5P2S |
| Molecular Weight | 277.22 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | (hydroxy-propan-2-ylimino-propan-2-ylsulfanyl-λ5-phosphanyl) dihydrogen phosphate |
| SMILES | CC(C)N=P(O)(OP(=O)(O)O)SC(C)C |
| InChI | InChI=1S/C6H17NO5P2S/c1-5(2)7-13(8,15-6(3)4)12-14(9,10)11/h5-6,8H,1-4H3,(H2,9,10,11) |
| InChIKey | OGGQEMWNWNBTEF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.22 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|