C20H27N5O4 — CID 21122886
(2R,3S,5R)-5-[2-(4-butylanilino)purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol;hydrate (PubChem CID 21122886) has the molecular formula C20H27N5O4 and a molecular weight of 401.47 g/mol. Its IUPAC name is (2R,3S,5R)-5-[2-(4-butylanilino)purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol;hydrate.
| Compound Name | (2R,3S,5R)-5-[2-(4-butylanilino)purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol;hydrate |
|---|---|
| PubChem CID | 21122886 |
| Molecular Formula | C20H27N5O4 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | (2R,3S,5R)-5-[2-(4-butylanilino)purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol;hydrate |
| SMILES | CCCCc1ccc(Nc2ncc3ncn([C@H]4C[C@H](O)[C@@H](CO)O4)c3n2)cc1.O |
| InChI | InChI=1S/C20H25N5O3.H2O/c1-2-3-4-13-5-7-14(8-6-13)23-20-21-10-15-19(24-20)25(12-22-15)18-9-16(27)17(11-26)28-18;/h5-8,10,12,16-18,26-27H,2-4,9,11H2,1H3,(H,21,23,24);1H2/t16-,17+,18+;/m0./s1 |
| InChIKey | IWCUOXHWGGVFSB-QQBJDQAASA-N |
| XLogP | 1.73 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |