C17H13NO3 — CID 21124222
(4R,6S,7S,8R)-5-oxa-10-azapentacyclo[9.8.0.03,9.04,6.012,17]nonadeca-1,3(9),10,12,14,16,18-heptaene-7,8-diol (PubChem CID 21124222) has the molecular formula C17H13NO3 and a molecular weight of 279.29 g/mol. Its IUPAC name is (4R,6S,7S,8R)-5-oxa-10-azapentacyclo[9.8.0.03,9.04,6.012,17]nonadeca-1,3(9),10,12,14,16,18-heptaene-7,8-diol.
| Compound Name | (4R,6S,7S,8R)-5-oxa-10-azapentacyclo[9.8.0.03,9.04,6.012,17]nonadeca-1,3(9),10,12,14,16,18-heptaene-7,8-diol |
|---|---|
| PubChem CID | 21124222 |
| Molecular Formula | C17H13NO3 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | (4R,6S,7S,8R)-5-oxa-10-azapentacyclo[9.8.0.03,9.04,6.012,17]nonadeca-1,3(9),10,12,14,16,18-heptaene-7,8-diol |
| SMILES | O[C@@H]1[C@@H]2O[C@@H]2c2cc3ccc4ccccc4c3nc2[C@H]1O |
| InChI | InChI=1S/C17H13NO3/c19-14-13-11(16-17(21-16)15(14)20)7-9-6-5-8-3-1-2-4-10(8)12(9)18-13/h1-7,14-17,19-20H/t14-,15+,16-,17+/m1/s1 |
| InChIKey | VCPRLARWVRVGNP-TWMKSMIVSA-N |
| XLogP | 2.24 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|